C20H19N4OS2+ — CID 3389958
2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 3389958) has the molecular formula C20H19N4OS2+ and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 3389958 |
| Molecular Formula | C20H19N4OS2+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)CSc3[nH]c4ccccc4[n+]3C)n2)cc1 |
| InChI | InChI=1S/C20H18N4OS2/c1-13-7-9-14(10-8-13)16-11-26-19(21-16)23-18(25)12-27-20-22-15-5-3-4-6-17(15)24(20)2/h3-11H,12H2,1-2H3,(H,21,23,25)/p+1 |
| InChIKey | ZRBVZAVTDGGWOA-UHFFFAOYSA-O |
| XLogP | 4.16 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|