C26H27N4O2S+ — CID 3285570
2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 3285570) has the molecular formula C26H27N4O2S+ and a molecular weight of 459.60 g/mol. Its IUPAC name is 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 3285570 |
| Molecular Formula | C26H27N4O2S+ |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | O=C(CSc1[nH]c2ccccc2[n+]1Cc1ccccc1)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H26N4O2S/c31-25(27-21-10-12-22(13-11-21)29-14-16-32-17-15-29)19-33-26-28-23-8-4-5-9-24(23)30(26)18-20-6-2-1-3-7-20/h1-13H,14-19H2,(H,27,31)/p+1 |
| InChIKey | YJFZNSOCVSQFKT-UHFFFAOYSA-O |
| XLogP | 4.07 |
| TPSA | 61.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|