C28H32N5OS+ — CID 4552389
2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]acetamide (PubChem CID 4552389) has the molecular formula C28H32N5OS+ and a molecular weight of 486.67 g/mol. Its IUPAC name is 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 4552389 |
| Molecular Formula | C28H32N5OS+ |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CSc3[nH]c4ccccc4[n+]3Cc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C28H31N5OS/c1-2-31-16-18-32(19-17-31)24-14-12-23(13-15-24)29-27(34)21-35-28-30-25-10-6-7-11-26(25)33(28)20-22-8-4-3-5-9-22/h3-15H,2,16-21H2,1H3,(H,29,34)/p+1 |
| InChIKey | LLWPPIVCXLAUFO-UHFFFAOYSA-O |
| XLogP | 4.38 |
| TPSA | 55.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|