C23H21BrN3OS+ — CID 4558162
2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(4-bromo-3-methylphenyl)acetamide (PubChem CID 4558162) has the molecular formula C23H21BrN3OS+ and a molecular weight of 467.41 g/mol. Its IUPAC name is 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(4-bromo-3-methylphenyl)acetamide.
| Compound Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(4-bromo-3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4558162 |
| Molecular Formula | C23H21BrN3OS+ |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(4-bromo-3-methylphenyl)acetamide |
| SMILES | Cc1cc(NC(=O)CSc2[nH]c3ccccc3[n+]2Cc2ccccc2)ccc1Br |
| InChI | InChI=1S/C23H20BrN3OS/c1-16-13-18(11-12-19(16)24)25-22(28)15-29-23-26-20-9-5-6-10-21(20)27(23)14-17-7-3-2-4-8-17/h2-13H,14-15H2,1H3,(H,25,28)/p+1 |
| InChIKey | OMXCAAHSDBPZHX-UHFFFAOYSA-O |
| XLogP | 5.31 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|