C22H19ClN3O3S2+ — CID 6381352
2-[[3-(benzenesulfonyl)-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-(3-chloro-4-methylphenyl)acetamide (PubChem CID 6381352) has the molecular formula C22H19ClN3O3S2+ and a molecular weight of 473.00 g/mol. Its IUPAC name is 2-[[3-(benzenesulfonyl)-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-(3-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-[[3-(benzenesulfonyl)-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-(3-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 6381352 |
| Molecular Formula | C22H19ClN3O3S2+ |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 2-[[3-(benzenesulfonyl)-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-(3-chloro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2[nH]c3ccccc3[n+]2S(=O)(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C22H18ClN3O3S2/c1-15-11-12-16(13-18(15)23)24-21(27)14-30-22-25-19-9-5-6-10-20(19)26(22)31(28,29)17-7-3-2-4-8-17/h2-13H,14H2,1H3,(H,24,27)/p+1 |
| InChIKey | BBQBSEZOQKYOFJ-UHFFFAOYSA-O |
| XLogP | 4.39 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|