C26H23FN6O3S — CID 5000292
N-[4-[4-(4-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide (PubChem CID 5000292) has the molecular formula C26H23FN6O3S and a molecular weight of 518.57 g/mol. Its IUPAC name is N-[4-[4-(4-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[4-[4-(4-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 5000292 |
| Molecular Formula | C26H23FN6O3S |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | N-[4-[4-(4-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[(5-pyridin-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccn2)o1)Nc1ccc(N2CCN(C(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H23FN6O3S/c27-19-6-4-18(5-7-19)25(35)33-15-13-32(14-16-33)21-10-8-20(9-11-21)29-23(34)17-37-26-31-30-24(36-26)22-3-1-2-12-28-22/h1-12H,13-17H2,(H,29,34) |
| InChIKey | WWFOUWSCVCTCLH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|