C26H24F3N4O4S2+ — CID 6390795
2-[[3-(benzenesulfonyl)-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-[2-morpholin-4-yl-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 6390795) has the molecular formula C26H24F3N4O4S2+ and a molecular weight of 577.63 g/mol. Its IUPAC name is 2-[[3-(benzenesulfonyl)-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-[2-morpholin-4-yl-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[3-(benzenesulfonyl)-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-[2-morpholin-4-yl-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 6390795 |
| Molecular Formula | C26H24F3N4O4S2+ |
| Molecular Weight | 577.63 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | 2-[[3-(benzenesulfonyl)-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-[2-morpholin-4-yl-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1[nH]c2ccccc2[n+]1S(=O)(=O)c1ccccc1)Nc1ccc(C(F)(F)F)cc1N1CCOCC1 |
| InChI | InChI=1S/C26H23F3N4O4S2/c27-26(28,29)18-10-11-21(23(16-18)32-12-14-37-15-13-32)30-24(34)17-38-25-31-20-8-4-5-9-22(20)33(25)39(35,36)19-6-2-1-3-7-19/h1-11,16H,12-15,17H2,(H,30,34)/p+1 |
| InChIKey | FGNHNRFEMKIJTF-UHFFFAOYSA-O |
| XLogP | 4.28 |
| TPSA | 95.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|