C18H23N5OS2 — CID 4544442
2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide (PubChem CID 4544442) has the molecular formula C18H23N5OS2 and a molecular weight of 389.55 g/mol. Its IUPAC name is 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 4544442 |
| Molecular Formula | C18H23N5OS2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide |
| SMILES | C=CCN1CCN(c2ccc(NC(=O)CSc3nnc(C)s3)cc2)CC1 |
| InChI | InChI=1S/C18H23N5OS2/c1-3-8-22-9-11-23(12-10-22)16-6-4-15(5-7-16)19-17(24)13-25-18-21-20-14(2)26-18/h3-7H,1,8-13H2,2H3,(H,19,24) |
| InChIKey | OQFXMZYQLISXIR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|