C22H23ClN4O2S2 — CID 3647952
N-[4-[4-(3-chlorobenzoyl)piperazin-1-yl]phenyl]-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetamide (PubChem CID 3647952) has the molecular formula C22H23ClN4O2S2 and a molecular weight of 475.04 g/mol. Its IUPAC name is N-[4-[4-(3-chlorobenzoyl)piperazin-1-yl]phenyl]-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetamide.
| Compound Name | N-[4-[4-(3-chlorobenzoyl)piperazin-1-yl]phenyl]-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 3647952 |
| Molecular Formula | C22H23ClN4O2S2 |
| Molecular Weight | 475.04 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[4-[4-(3-chlorobenzoyl)piperazin-1-yl]phenyl]-2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)acetamide |
| SMILES | O=C(CSC1=NCCS1)Nc1ccc(N2CCN(C(=O)c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C22H23ClN4O2S2/c23-17-3-1-2-16(14-17)21(29)27-11-9-26(10-12-27)19-6-4-18(5-7-19)25-20(28)15-31-22-24-8-13-30-22/h1-7,14H,8-13,15H2,(H,25,28) |
| InChIKey | IUTWRPRLKIJMKU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.04 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|