C25H23ClFN3O2S — CID 4544621
2-(4-chlorophenyl)sulfanyl-N-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 4544621) has the molecular formula C25H23ClFN3O2S and a molecular weight of 484.00 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 4544621 |
| Molecular Formula | C25H23ClFN3O2S |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[4-[4-(3-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)Nc1ccc(N2CCN(C(=O)c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C25H23ClFN3O2S/c26-19-4-10-23(11-5-19)33-17-24(31)28-21-6-8-22(9-7-21)29-12-14-30(15-13-29)25(32)18-2-1-3-20(27)16-18/h1-11,16H,12-15,17H2,(H,28,31) |
| InChIKey | BYVRQKFAYDZICC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|