C21H22BrN5O4S2 — CID 3683510
2-[[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]acetamide (PubChem CID 3683510) has the molecular formula C21H22BrN5O4S2 and a molecular weight of 552.48 g/mol. Its IUPAC name is 2-[[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 3683510 |
| Molecular Formula | C21H22BrN5O4S2 |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 551.03 |
| IUPAC Name | 2-[[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(NC(=O)CSc3nnc(-c4cccc(Br)c4)o3)cc2)CC1 |
| InChI | InChI=1S/C21H22BrN5O4S2/c1-33(29,30)27-11-9-26(10-12-27)18-7-5-17(6-8-18)23-19(28)14-32-21-25-24-20(31-21)15-3-2-4-16(22)13-15/h2-8,13H,9-12,14H2,1H3,(H,23,28) |
| InChIKey | YDRWHOPNTLSVIZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|