C28H24ClFN4O2S2 — CID 3551114
2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 3551114) has the molecular formula C28H24ClFN4O2S2 and a molecular weight of 567.11 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3551114 |
| Molecular Formula | C28H24ClFN4O2S2 |
| Molecular Weight | 567.11 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | O=C(CSc1nc(-c2ccc(Cl)cc2)cs1)Nc1ccc(N2CCN(C(=O)c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C28H24ClFN4O2S2/c29-20-7-5-19(6-8-20)25-17-37-28(32-25)38-18-26(35)31-21-9-11-22(12-10-21)33-13-15-34(16-14-33)27(36)23-3-1-2-4-24(23)30/h1-12,17H,13-16,18H2,(H,31,35) |
| InChIKey | VSBOGDCKTJNHCR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.11 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|