C24H26FN5O3S — CID 5185518
N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide (PubChem CID 5185518) has the molecular formula C24H26FN5O3S and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 5185518 |
| Molecular Formula | C24H26FN5O3S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
| SMILES | CC(C)c1nnc(SCC(=O)Nc2ccc(N3CCN(C(=O)c4ccccc4F)CC3)cc2)o1 |
| InChI | InChI=1S/C24H26FN5O3S/c1-16(2)22-27-28-24(33-22)34-15-21(31)26-17-7-9-18(10-8-17)29-11-13-30(14-12-29)23(32)19-5-3-4-6-20(19)25/h3-10,16H,11-15H2,1-2H3,(H,26,31) |
| InChIKey | SVXZFKBTERFFRU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|