C28H26FN5O3S — CID 3941295
2-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 3941295) has the molecular formula C28H26FN5O3S and a molecular weight of 531.61 g/mol. Its IUPAC name is 2-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3941295 |
| Molecular Formula | C28H26FN5O3S |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 2-[[5-(2-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | Cc1ccccc1C(=O)N1CCN(c2ccc(NC(=O)CSc3nnc(-c4ccccc4F)o3)cc2)CC1 |
| InChI | InChI=1S/C28H26FN5O3S/c1-19-6-2-3-7-22(19)27(36)34-16-14-33(15-17-34)21-12-10-20(11-13-21)30-25(35)18-38-28-32-31-26(37-28)23-8-4-5-9-24(23)29/h2-13H,14-18H2,1H3,(H,30,35) |
| InChIKey | NVTHVRCEKUXWIP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|