C27H23ClN6O5S — CID 5125719
N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 5125719) has the molecular formula C27H23ClN6O5S and a molecular weight of 579.04 g/mol. Its IUPAC name is N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 5125719 |
| Molecular Formula | C27H23ClN6O5S |
| Molecular Weight | 579.04 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-2-[[5-(2-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2[N+](=O)[O-])o1)Nc1ccc(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H23ClN6O5S/c28-19-7-5-18(6-8-19)26(36)33-15-13-32(14-16-33)21-11-9-20(10-12-21)29-24(35)17-40-27-31-30-25(39-27)22-3-1-2-4-23(22)34(37)38/h1-12H,13-17H2,(H,29,35) |
| InChIKey | ZWQPYYIZFIIMOE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.04 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|