C23H22ClN5O2S — CID 4018062
2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-prop-2-ynylpiperazin-1-yl)phenyl]acetamide (PubChem CID 4018062) has the molecular formula C23H22ClN5O2S and a molecular weight of 467.98 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-prop-2-ynylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-prop-2-ynylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 4018062 |
| Molecular Formula | C23H22ClN5O2S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-prop-2-ynylpiperazin-1-yl)phenyl]acetamide |
| SMILES | C#CCN1CCN(c2ccc(NC(=O)CSc3nnc(-c4ccccc4Cl)o3)cc2)CC1 |
| InChI | InChI=1S/C23H22ClN5O2S/c1-2-11-28-12-14-29(15-13-28)18-9-7-17(8-10-18)25-21(30)16-32-23-27-26-22(31-23)19-5-3-4-6-20(19)24/h1,3-10H,11-16H2,(H,25,30) |
| InChIKey | ISBFORUUGOMFOF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|