C19H13ClN4O4S — CID 55332945
2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide (PubChem CID 55332945) has the molecular formula C19H13ClN4O4S and a molecular weight of 428.86 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
|---|---|
| PubChem CID | 55332945 |
| Molecular Formula | C19H13ClN4O4S |
| Molecular Weight | 428.86 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)CSc3nnc(-c4ccc(Cl)cc4)o3)cc2C1=O |
| InChI | InChI=1S/C19H13ClN4O4S/c1-24-17(26)13-7-6-12(8-14(13)18(24)27)21-15(25)9-29-19-23-22-16(28-19)10-2-4-11(20)5-3-10/h2-8H,9H2,1H3,(H,21,25) |
| InChIKey | AHYIHJJTMVBCAU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|