C18H15ClF2N4O2S — CID 55908081
2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(dimethylamino)-3,5-difluorophenyl]acetamide (PubChem CID 55908081) has the molecular formula C18H15ClF2N4O2S and a molecular weight of 424.86 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(dimethylamino)-3,5-difluorophenyl]acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(dimethylamino)-3,5-difluorophenyl]acetamide |
|---|---|
| PubChem CID | 55908081 |
| Molecular Formula | C18H15ClF2N4O2S |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(dimethylamino)-3,5-difluorophenyl]acetamide |
| SMILES | CN(C)c1c(F)cc(NC(=O)CSc2nnc(-c3ccc(Cl)cc3)o2)cc1F |
| InChI | InChI=1S/C18H15ClF2N4O2S/c1-25(2)16-13(20)7-12(8-14(16)21)22-15(26)9-28-18-24-23-17(27-18)10-3-5-11(19)6-4-10/h3-8H,9H2,1-2H3,(H,22,26) |
| InChIKey | JWNCEOFCTLTDJL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|