C22H17N5O2S — CID 6522506
(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl) (1Z)-N-(4-methylanilino)-2-oxo-2-phenylethanimidothioate (PubChem CID 6522506) has the molecular formula C22H17N5O2S and a molecular weight of 415.48 g/mol. Its IUPAC name is (5-pyridin-3-yl-1,3,4-oxadiazol-2-yl) (1Z)-N-(4-methylanilino)-2-oxo-2-phenylethanimidothioate.
| Compound Name | (5-pyridin-3-yl-1,3,4-oxadiazol-2-yl) (1Z)-N-(4-methylanilino)-2-oxo-2-phenylethanimidothioate |
|---|---|
| PubChem CID | 6522506 |
| Molecular Formula | C22H17N5O2S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (5-pyridin-3-yl-1,3,4-oxadiazol-2-yl) (1Z)-N-(4-methylanilino)-2-oxo-2-phenylethanimidothioate |
| SMILES | Cc1ccc(N/N=C(\Sc2nnc(-c3cccnc3)o2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H17N5O2S/c1-15-9-11-18(12-10-15)24-26-21(19(28)16-6-3-2-4-7-16)30-22-27-25-20(29-22)17-8-5-13-23-14-17/h2-14,24H,1H3/b26-21- |
| InChIKey | QPKRMWJSJODGBY-QLYXXIJNSA-N |
| XLogP | 4.84 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|