C23H14Cl2N6O7S — CID 45135609
[5-[(2,4-dichlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl] (1E)-N-(4-nitroanilino)-2-(3-nitrophenyl)-2-oxoethanimidothioate (PubChem CID 45135609) has the molecular formula C23H14Cl2N6O7S and a molecular weight of 589.37 g/mol. Its IUPAC name is [5-[(2,4-dichlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl] (1E)-N-(4-nitroanilino)-2-(3-nitrophenyl)-2-oxoethanimidothioate.
| Compound Name | [5-[(2,4-dichlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl] (1E)-N-(4-nitroanilino)-2-(3-nitrophenyl)-2-oxoethanimidothioate |
|---|---|
| PubChem CID | 45135609 |
| Molecular Formula | C23H14Cl2N6O7S |
| Molecular Weight | 589.37 g/mol |
| Exact Mass | 588.00 |
| IUPAC Name | [5-[(2,4-dichlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl] (1E)-N-(4-nitroanilino)-2-(3-nitrophenyl)-2-oxoethanimidothioate |
| SMILES | O=C(/C(=N\Nc1ccc([N+](=O)[O-])cc1)Sc1nnc(COc2ccc(Cl)cc2Cl)o1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H14Cl2N6O7S/c24-14-4-9-19(18(25)11-14)37-12-20-27-29-23(38-20)39-22(21(32)13-2-1-3-17(10-13)31(35)36)28-26-15-5-7-16(8-6-15)30(33)34/h1-11,26H,12H2/b28-22+ |
| InChIKey | JGHBWKLPOQMKIC-XAYXJRQQSA-N |
| XLogP | 6.17 |
| TPSA | 175.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.37 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|