C11H8ClN3O5S — CID 56968609
S-[5-[(3-nitrophenoxy)methyl]-1,3,4-oxadiazol-2-yl] 2-chloroethanethioate (PubChem CID 56968609) has the molecular formula C11H8ClN3O5S and a molecular weight of 329.72 g/mol. Its IUPAC name is S-[5-[(3-nitrophenoxy)methyl]-1,3,4-oxadiazol-2-yl] 2-chloroethanethioate.
| Compound Name | S-[5-[(3-nitrophenoxy)methyl]-1,3,4-oxadiazol-2-yl] 2-chloroethanethioate |
|---|---|
| PubChem CID | 56968609 |
| Molecular Formula | C11H8ClN3O5S |
| Molecular Weight | 329.72 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | S-[5-[(3-nitrophenoxy)methyl]-1,3,4-oxadiazol-2-yl] 2-chloroethanethioate |
| SMILES | O=C(CCl)Sc1nnc(COc2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C11H8ClN3O5S/c12-5-10(16)21-11-14-13-9(20-11)6-19-8-3-1-2-7(4-8)15(17)18/h1-4H,5-6H2 |
| InChIKey | YZKYWTLNIVIHEG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.72 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|