C26H30Cl2N4O4S — CID 137162288
N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[[5-[(2,4-dichlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 137162288) has the molecular formula C26H30Cl2N4O4S and a molecular weight of 565.52 g/mol. Its IUPAC name is N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[[5-[(2,4-dichlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[[5-[(2,4-dichlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 137162288 |
| Molecular Formula | C26H30Cl2N4O4S |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | N-[(Z)-(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[[5-[(2,4-dichlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CC(C)(C)c1cc(/C=N\NC(=O)CSc2nnc(COc3ccc(Cl)cc3Cl)o2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H30Cl2N4O4S/c1-25(2,3)17-9-15(10-18(23(17)34)26(4,5)6)12-29-30-21(33)14-37-24-32-31-22(36-24)13-35-20-8-7-16(27)11-19(20)28/h7-12,34H,13-14H2,1-6H3,(H,30,33)/b29-12- |
| InChIKey | OGLYTKFRCQLRAR-ULPWCQAASA-N |
| XLogP | 6.50 |
| TPSA | 109.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|