C20H30N5O2S+ — CID 5026486
N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[(4-methyl-1H-1,2,4-triazol-4-ium-5-yl)sulfanyl]acetamide (PubChem CID 5026486) has the molecular formula C20H30N5O2S+ and a molecular weight of 404.56 g/mol. Its IUPAC name is N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[(4-methyl-1H-1,2,4-triazol-4-ium-5-yl)sulfanyl]acetamide.
| Compound Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[(4-methyl-1H-1,2,4-triazol-4-ium-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 5026486 |
| Molecular Formula | C20H30N5O2S+ |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[(4-methyl-1H-1,2,4-triazol-4-ium-5-yl)sulfanyl]acetamide |
| SMILES | C[n+]1cn[nH]c1SCC(=O)NN=Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H29N5O2S/c1-19(2,3)14-8-13(9-15(17(14)27)20(4,5)6)10-21-23-16(26)11-28-18-24-22-12-25(18)7/h8-10,12H,11H2,1-7H3,(H2,21,23,26,27)/p+1 |
| InChIKey | XQYFTIIMRLAJKW-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|