C31H34N4O3S — CID 3957106
N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide (PubChem CID 3957106) has the molecular formula C31H34N4O3S and a molecular weight of 542.71 g/mol. Its IUPAC name is N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3957106 |
| Molecular Formula | C31H34N4O3S |
| Molecular Weight | 542.71 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
| SMILES | CC(C)(C)c1cc(C=NNC(=O)CSc2nc3ccccc3c(=O)n2-c2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C31H34N4O3S/c1-30(2,3)23-16-20(17-24(27(23)37)31(4,5)6)18-32-34-26(36)19-39-29-33-25-15-11-10-14-22(25)28(38)35(29)21-12-8-7-9-13-21/h7-18,37H,19H2,1-6H3,(H,34,36) |
| InChIKey | JNQXCWRAKMODLK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.71 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|