C19H16Cl2N4O5S — CID 126017225
2-[[5-[3-(2,4-dichlorophenoxy)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 126017225) has the molecular formula C19H16Cl2N4O5S and a molecular weight of 483.33 g/mol. Its IUPAC name is 2-[[5-[3-(2,4-dichlorophenoxy)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[3-(2,4-dichlorophenoxy)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126017225 |
| Molecular Formula | C19H16Cl2N4O5S |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | 2-[[5-[3-(2,4-dichlorophenoxy)propyl]-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nnc(CCCOc2ccc(Cl)cc2Cl)o1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16Cl2N4O5S/c20-12-3-8-16(15(21)10-12)29-9-1-2-18-23-24-19(30-18)31-11-17(26)22-13-4-6-14(7-5-13)25(27)28/h3-8,10H,1-2,9,11H2,(H,22,26) |
| InChIKey | CXILNMPTEKVULQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|