C15H10N3O3S- — CID 6957488
3-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzoate (PubChem CID 6957488) has the molecular formula C15H10N3O3S- and a molecular weight of 312.33 g/mol. Its IUPAC name is 3-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzoate.
| Compound Name | 3-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 6957488 |
| Molecular Formula | C15H10N3O3S- |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 3-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzoate |
| SMILES | O=C([O-])c1cccc(CSc2nnc(-c3ccncc3)o2)c1 |
| InChI | InChI=1S/C15H11N3O3S/c19-14(20)12-3-1-2-10(8-12)9-22-15-18-17-13(21-15)11-4-6-16-7-5-11/h1-8H,9H2,(H,19,20)/p-1 |
| InChIKey | YGJKMSYPNYBKEQ-UHFFFAOYSA-M |
| XLogP | 1.79 |
| TPSA | 91.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |