C17H15N3O2S — CID 29310891
1-phenyl-4-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]butan-1-one (PubChem CID 29310891) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is 1-phenyl-4-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]butan-1-one.
| Compound Name | 1-phenyl-4-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 29310891 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 1-phenyl-4-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]butan-1-one |
| SMILES | O=C(CCCSc1nnc(-c2ccncc2)o1)c1ccccc1 |
| InChI | InChI=1S/C17H15N3O2S/c21-15(13-5-2-1-3-6-13)7-4-12-23-17-20-19-16(22-17)14-8-10-18-11-9-14/h1-3,5-6,8-11H,4,7,12H2 |
| InChIKey | NNFBVZKTLHVXBH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|