C14H12N2O3S — CID 61406569
4-[5-(1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]butanoic acid (PubChem CID 61406569) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is 4-[5-(1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]butanoic acid.
| Compound Name | 4-[5-(1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 61406569 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 4-[5-(1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]butanoic acid |
| SMILES | O=C(O)CCCc1nnc(-c2cc3ccccc3s2)o1 |
| InChI | InChI=1S/C14H12N2O3S/c17-13(18)7-3-6-12-15-16-14(19-12)11-8-9-4-1-2-5-10(9)20-11/h1-2,4-5,8H,3,6-7H2,(H,17,18) |
| InChIKey | RHNFAXKLBUEEBH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |