C23H25N5O2 — CID 11761244
5-methyl-2-phenyl-4-[[4-[5-(2H-tetrazol-5-yl)pentyl]phenoxy]methyl]-1,3-oxazole (PubChem CID 11761244) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 5-methyl-2-phenyl-4-[[4-[5-(2H-tetrazol-5-yl)pentyl]phenoxy]methyl]-1,3-oxazole.
| Compound Name | 5-methyl-2-phenyl-4-[[4-[5-(2H-tetrazol-5-yl)pentyl]phenoxy]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 11761244 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 5-methyl-2-phenyl-4-[[4-[5-(2H-tetrazol-5-yl)pentyl]phenoxy]methyl]-1,3-oxazole |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc(CCCCCc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C23H25N5O2/c1-17-21(24-23(30-17)19-9-5-3-6-10-19)16-29-20-14-12-18(13-15-20)8-4-2-7-11-22-25-27-28-26-22/h3,5-6,9-10,12-15H,2,4,7-8,11,16H2,1H3,(H,25,26,27,28) |
| InChIKey | AADNKIUZFDKBMQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|