C23H23NO6 — CID 139706521
3-[2-(methoxymethoxy)-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 139706521) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is 3-[2-(methoxymethoxy)-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[2-(methoxymethoxy)-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139706521 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 3-[2-(methoxymethoxy)-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | COCOc1cc(OCCc2nc(-c3ccccc3)oc2C)ccc1C=CC(=O)O |
| InChI | InChI=1S/C23H23NO6/c1-16-20(24-23(30-16)18-6-4-3-5-7-18)12-13-28-19-10-8-17(9-11-22(25)26)21(14-19)29-15-27-2/h3-11,14H,12-13,15H2,1-2H3,(H,25,26) |
| InChIKey | IIRYTENOCYPAOI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|