C27H25NO5 — CID 18003549
2-[(4-methoxyphenyl)methoxy]-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]benzaldehyde (PubChem CID 18003549) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methoxy]-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]benzaldehyde.
| Compound Name | 2-[(4-methoxyphenyl)methoxy]-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 18003549 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-[(4-methoxyphenyl)methoxy]-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]benzaldehyde |
| SMILES | COc1ccc(COc2cc(OCCc3nc(-c4ccccc4)oc3C)ccc2C=O)cc1 |
| InChI | InChI=1S/C27H25NO5/c1-19-25(28-27(33-19)21-6-4-3-5-7-21)14-15-31-24-13-10-22(17-29)26(16-24)32-18-20-8-11-23(30-2)12-9-20/h3-13,16-17H,14-15,18H2,1-2H3 |
| InChIKey | UGXWZSYRAMYNQM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|