C18H15NO3S — CID 71899790
(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 3-thiophen-3-ylprop-2-enoate (PubChem CID 71899790) has the molecular formula C18H15NO3S and a molecular weight of 325.39 g/mol. Its IUPAC name is (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 3-thiophen-3-ylprop-2-enoate.
| Compound Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 3-thiophen-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 71899790 |
| Molecular Formula | C18H15NO3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 3-thiophen-3-ylprop-2-enoate |
| SMILES | Cc1oc(-c2ccccc2)nc1COC(=O)C=Cc1ccsc1 |
| InChI | InChI=1S/C18H15NO3S/c1-13-16(19-18(22-13)15-5-3-2-4-6-15)11-21-17(20)8-7-14-9-10-23-12-14/h2-10,12H,11H2,1H3 |
| InChIKey | AVKKAMSDBRIAAN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|