C20H20FN3O4 — CID 10738851
1-[[4-[2-[2-(3-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]phenyl]methyl]-1-hydroxyurea (PubChem CID 10738851) has the molecular formula C20H20FN3O4 and a molecular weight of 385.40 g/mol. Its IUPAC name is 1-[[4-[2-[2-(3-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]phenyl]methyl]-1-hydroxyurea.
| Compound Name | 1-[[4-[2-[2-(3-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]phenyl]methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 10738851 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-[[4-[2-[2-(3-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]phenyl]methyl]-1-hydroxyurea |
| SMILES | Cc1oc(-c2cccc(F)c2)nc1CCOc1ccc(CN(O)C(N)=O)cc1 |
| InChI | InChI=1S/C20H20FN3O4/c1-13-18(23-19(28-13)15-3-2-4-16(21)11-15)9-10-27-17-7-5-14(6-8-17)12-24(26)20(22)25/h2-8,11,26H,9-10,12H2,1H3,(H2,22,25) |
| InChIKey | FJLAWHZUOJTOHW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|