C27H25N3O6 — CID 15646285
[carbamoyl-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]amino] phenyl carbonate (PubChem CID 15646285) has the molecular formula C27H25N3O6 and a molecular weight of 487.51 g/mol. Its IUPAC name is [carbamoyl-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]amino] phenyl carbonate.
| Compound Name | [carbamoyl-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]amino] phenyl carbonate |
|---|---|
| PubChem CID | 15646285 |
| Molecular Formula | C27H25N3O6 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | [carbamoyl-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]amino] phenyl carbonate |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc(CN(OC(=O)Oc2ccccc2)C(N)=O)cc1 |
| InChI | InChI=1S/C27H25N3O6/c1-19-24(29-25(34-19)21-8-4-2-5-9-21)16-17-33-22-14-12-20(13-15-22)18-30(26(28)31)36-27(32)35-23-10-6-3-7-11-23/h2-15H,16-18H2,1H3,(H2,28,31) |
| InChIKey | QXOGFGMWJOMUHF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|