C22H25N3O4 — CID 15289785
1-[[2,6-dimethyl-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1-hydroxyurea (PubChem CID 15289785) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-[[2,6-dimethyl-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1-hydroxyurea.
| Compound Name | 1-[[2,6-dimethyl-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 15289785 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[[2,6-dimethyl-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1-hydroxyurea |
| SMILES | Cc1cc(OCCc2nc(-c3ccccc3)oc2C)cc(C)c1CN(O)C(N)=O |
| InChI | InChI=1S/C22H25N3O4/c1-14-11-18(12-15(2)19(14)13-25(27)22(23)26)28-10-9-20-16(3)29-21(24-20)17-7-5-4-6-8-17/h4-8,11-12,27H,9-10,13H2,1-3H3,(H2,23,26) |
| InChIKey | UNORFVHYMRMORO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|