C24H25FN2O5 — CID 91370500
2-[[4-[2-[2-(3-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]phenyl]methyl]-3-(methoxyamino)but-2-enoic acid (PubChem CID 91370500) has the molecular formula C24H25FN2O5 and a molecular weight of 440.47 g/mol. Its IUPAC name is 2-[[4-[2-[2-(3-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]phenyl]methyl]-3-(methoxyamino)but-2-enoic acid.
| Compound Name | 2-[[4-[2-[2-(3-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]phenyl]methyl]-3-(methoxyamino)but-2-enoic acid |
|---|---|
| PubChem CID | 91370500 |
| Molecular Formula | C24H25FN2O5 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-[[4-[2-[2-(3-fluorophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]phenyl]methyl]-3-(methoxyamino)but-2-enoic acid |
| SMILES | CONC(C)=C(Cc1ccc(OCCc2nc(-c3cccc(F)c3)oc2C)cc1)C(=O)O |
| InChI | InChI=1S/C24H25FN2O5/c1-15(27-30-3)21(24(28)29)13-17-7-9-20(10-8-17)31-12-11-22-16(2)32-23(26-22)18-5-4-6-19(25)14-18/h4-10,14,27H,11-13H2,1-3H3,(H,28,29) |
| InChIKey | VAYCWKSXLWFEHB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|