C23H37ClNOP — CID 139973551
tributyl-chloro-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-λ5-phosphane (PubChem CID 139973551) has the molecular formula C23H37ClNOP and a molecular weight of 409.98 g/mol. Its IUPAC name is tributyl-chloro-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-λ5-phosphane.
| Compound Name | tributyl-chloro-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-λ5-phosphane |
|---|---|
| PubChem CID | 139973551 |
| Molecular Formula | C23H37ClNOP |
| Molecular Weight | 409.98 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | tributyl-chloro-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-λ5-phosphane |
| SMILES | CCCCP(Cl)(CCCC)(CCCC)Cc1nc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C23H37ClNOP/c1-5-8-16-27(24,17-9-6-2,18-10-7-3)19-22-20(4)26-23(25-22)21-14-12-11-13-15-21/h11-15H,5-10,16-19H2,1-4H3 |
| InChIKey | VMEUJXKEYLLOBU-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.98 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|