C30H37BrN2O3 — CID 159710828
4-(5-bromopentyl)-5-methyl-2-phenyl-1,3-oxazole;5-(5-methyl-2-phenyl-1,3-oxazol-4-yl)pentan-1-ol (PubChem CID 159710828) has the molecular formula C30H37BrN2O3 and a molecular weight of 553.54 g/mol. Its IUPAC name is 4-(5-bromopentyl)-5-methyl-2-phenyl-1,3-oxazole;5-(5-methyl-2-phenyl-1,3-oxazol-4-yl)pentan-1-ol.
| Compound Name | 4-(5-bromopentyl)-5-methyl-2-phenyl-1,3-oxazole;5-(5-methyl-2-phenyl-1,3-oxazol-4-yl)pentan-1-ol |
|---|---|
| PubChem CID | 159710828 |
| Molecular Formula | C30H37BrN2O3 |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 4-(5-bromopentyl)-5-methyl-2-phenyl-1,3-oxazole;5-(5-methyl-2-phenyl-1,3-oxazol-4-yl)pentan-1-ol |
| SMILES | Cc1oc(-c2ccccc2)nc1CCCCCBr.Cc1oc(-c2ccccc2)nc1CCCCCO |
| InChI | InChI=1S/C15H18BrNO.C15H19NO2/c1-12-14(10-6-3-7-11-16)17-15(18-12)13-8-4-2-5-9-13;1-12-14(10-6-3-7-11-17)16-15(18-12)13-8-4-2-5-9-13/h2,4-5,8-9H,3,6-7,10-11H2,1H3;2,4-5,8-9,17H,3,6-7,10-11H2,1H3 |
| InChIKey | MYUWKXKKVOHIPY-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|