C19H16ClNO3 — CID 16621729
(2-chloro-5-methylphenyl) 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate (PubChem CID 16621729) has the molecular formula C19H16ClNO3 and a molecular weight of 341.79 g/mol. Its IUPAC name is (2-chloro-5-methylphenyl) 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate.
| Compound Name | (2-chloro-5-methylphenyl) 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate |
|---|---|
| PubChem CID | 16621729 |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (2-chloro-5-methylphenyl) 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate |
| SMILES | Cc1ccc(Cl)c(OC(=O)Cc2nc(-c3ccccc3)oc2C)c1 |
| InChI | InChI=1S/C19H16ClNO3/c1-12-8-9-15(20)17(10-12)24-18(22)11-16-13(2)23-19(21-16)14-6-4-3-5-7-14/h3-10H,11H2,1-2H3 |
| InChIKey | OVVJYWPSAQYXOM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|