C19H17NO4 — CID 31702472
(2-methoxyphenyl) 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate (PubChem CID 31702472) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2-methoxyphenyl) 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate.
| Compound Name | (2-methoxyphenyl) 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate |
|---|---|
| PubChem CID | 31702472 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (2-methoxyphenyl) 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate |
| SMILES | COc1ccccc1OC(=O)Cc1nc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C19H17NO4/c1-13-15(20-19(23-13)14-8-4-3-5-9-14)12-18(21)24-17-11-7-6-10-16(17)22-2/h3-11H,12H2,1-2H3 |
| InChIKey | OVRIUQFRXPXCEU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|