C16H22O4S4 — CID 59449623
2-[3-[4-[2-(carboxymethylsulfanyl)ethylsulfanylmethyl]phenyl]sulfanylpropylsulfanyl]acetic acid (PubChem CID 59449623) has the molecular formula C16H22O4S4 and a molecular weight of 406.62 g/mol. Its IUPAC name is 2-[3-[4-[2-(carboxymethylsulfanyl)ethylsulfanylmethyl]phenyl]sulfanylpropylsulfanyl]acetic acid.
| Compound Name | 2-[3-[4-[2-(carboxymethylsulfanyl)ethylsulfanylmethyl]phenyl]sulfanylpropylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 59449623 |
| Molecular Formula | C16H22O4S4 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-[3-[4-[2-(carboxymethylsulfanyl)ethylsulfanylmethyl]phenyl]sulfanylpropylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCCSc1ccc(CSCCSCC(=O)O)cc1 |
| InChI | InChI=1S/C16H22O4S4/c17-15(18)11-21-6-1-7-24-14-4-2-13(3-5-14)10-22-8-9-23-12-16(19)20/h2-5H,1,6-12H2,(H,17,18)(H,19,20) |
| InChIKey | UHWHASWLLJSBHP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|