C22H44O2S4 — CID 176740466
2,3-bis(hexyldisulfanyl)propyl 4,4-dimethylpentanoate (PubChem CID 176740466) has the molecular formula C22H44O2S4 and a molecular weight of 468.86 g/mol. Its IUPAC name is 2,3-bis(hexyldisulfanyl)propyl 4,4-dimethylpentanoate.
| Compound Name | 2,3-bis(hexyldisulfanyl)propyl 4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 176740466 |
| Molecular Formula | C22H44O2S4 |
| Molecular Weight | 468.86 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 2,3-bis(hexyldisulfanyl)propyl 4,4-dimethylpentanoate |
| SMILES | CCCCCCSSCC(COC(=O)CCC(C)(C)C)SSCCCCCC |
| InChI | InChI=1S/C22H44O2S4/c1-6-8-10-12-16-25-27-19-20(28-26-17-13-11-9-7-2)18-24-21(23)14-15-22(3,4)5/h20H,6-19H2,1-5H3 |
| InChIKey | UGKVPYHPQCPACF-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.86 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|