C45H87NO2S4 — CID 170389974
2,3-bis[[(Z)-octadec-9-enyl]disulfanyl]propyl 4-(dimethylamino)butanoate (PubChem CID 170389974) has the molecular formula C45H87NO2S4 and a molecular weight of 802.46 g/mol. Its IUPAC name is 2,3-bis[[(Z)-octadec-9-enyl]disulfanyl]propyl 4-(dimethylamino)butanoate.
| Compound Name | 2,3-bis[[(Z)-octadec-9-enyl]disulfanyl]propyl 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 170389974 |
| Molecular Formula | C45H87NO2S4 |
| Molecular Weight | 802.46 g/mol |
| Exact Mass | 801.56 |
| IUPAC Name | 2,3-bis[[(Z)-octadec-9-enyl]disulfanyl]propyl 4-(dimethylamino)butanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCSSCC(COC(=O)CCCN(C)C)SSCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C45H87NO2S4/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40-49-51-43-44(42-48-45(47)38-37-39-46(3)4)52-50-41-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,44H,5-18,23-43H2,1-4H3/b21-19-,22-20- |
| InChIKey | ZIQRNGJBPOXCOJ-WRBBJXAJSA-N |
| XLogP | 16.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.46 |
| LogP ≤ 5 | 16.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|