C61H121N3O5 — CID 164724530
bis(2-butyloctyl) 7-[3-(dimethylamino)propyl-[3-(dioctylamino)-3-oxopropyl]amino]tridecanedioate (PubChem CID 164724530) has the molecular formula C61H121N3O5 and a molecular weight of 976.65 g/mol. Its IUPAC name is bis(2-butyloctyl) 7-[3-(dimethylamino)propyl-[3-(dioctylamino)-3-oxopropyl]amino]tridecanedioate.
| Compound Name | bis(2-butyloctyl) 7-[3-(dimethylamino)propyl-[3-(dioctylamino)-3-oxopropyl]amino]tridecanedioate |
|---|---|
| PubChem CID | 164724530 |
| Molecular Formula | C61H121N3O5 |
| Molecular Weight | 976.65 g/mol |
| Exact Mass | 975.93 |
| IUPAC Name | bis(2-butyloctyl) 7-[3-(dimethylamino)propyl-[3-(dioctylamino)-3-oxopropyl]amino]tridecanedioate |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)CCN(CCCN(C)C)C(CCCCCC(=O)OCC(CCCC)CCCCCC)CCCCCC(=O)OCC(CCCC)CCCCCC |
| InChI | InChI=1S/C61H121N3O5/c1-9-15-21-25-27-37-50-64(51-38-28-26-22-16-10-2)59(65)48-53-63(52-39-49-62(7)8)58(44-33-29-35-46-60(66)68-54-56(40-19-13-5)42-31-23-17-11-3)45-34-30-36-47-61(67)69-55-57(41-20-14-6)43-32-24-18-12-4/h56-58H,9-55H2,1-8H3 |
| InChIKey | DAYOJXJGJNABHN-UHFFFAOYSA-N |
| XLogP | 17.09 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.65 |
| LogP ≤ 5 | 17.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|