C62H122N2O5 — CID 154645646
bis(2-butyloctyl) 10-[2-butyloctyl-[5-(dimethylamino)pentanoyl]amino]nonadecanedioate (PubChem CID 154645646) has the molecular formula C62H122N2O5 and a molecular weight of 975.67 g/mol. Its IUPAC name is bis(2-butyloctyl) 10-[2-butyloctyl-[5-(dimethylamino)pentanoyl]amino]nonadecanedioate.
| Compound Name | bis(2-butyloctyl) 10-[2-butyloctyl-[5-(dimethylamino)pentanoyl]amino]nonadecanedioate |
|---|---|
| PubChem CID | 154645646 |
| Molecular Formula | C62H122N2O5 |
| Molecular Weight | 975.67 g/mol |
| Exact Mass | 974.94 |
| IUPAC Name | bis(2-butyloctyl) 10-[2-butyloctyl-[5-(dimethylamino)pentanoyl]amino]nonadecanedioate |
| SMILES | CCCCCCC(CCCC)COC(=O)CCCCCCCCC(CCCCCCCCC(=O)OCC(CCCC)CCCCCC)N(CC(CCCC)CCCCCC)C(=O)CCCCN(C)C |
| InChI | InChI=1S/C62H122N2O5/c1-9-15-21-32-44-56(41-18-12-4)53-64(60(65)49-39-40-52-63(7)8)59(47-35-28-24-26-30-37-50-61(66)68-54-57(42-19-13-5)45-33-22-16-10-2)48-36-29-25-27-31-38-51-62(67)69-55-58(43-20-14-6)46-34-23-17-11-3/h56-59H,9-55H2,1-8H3 |
| InChIKey | DKJVPOBUDPTVEB-UHFFFAOYSA-N |
| XLogP | 18.57 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.67 |
| LogP ≤ 5 | 18.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|