C57H97F15N2O5 — CID 177078522
1-O-(2-hexyldecyl) 13-O-(2-hexyloctyl) 7-[4-(dimethylamino)butyl-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]tridecanedioate (PubChem CID 177078522) has the molecular formula C57H97F15N2O5 and a molecular weight of 1175.38 g/mol. Its IUPAC name is 1-O-(2-hexyldecyl) 13-O-(2-hexyloctyl) 7-[4-(dimethylamino)butyl-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]tridecanedioate.
| Compound Name | 1-O-(2-hexyldecyl) 13-O-(2-hexyloctyl) 7-[4-(dimethylamino)butyl-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]tridecanedioate |
|---|---|
| PubChem CID | 177078522 |
| Molecular Formula | C57H97F15N2O5 |
| Molecular Weight | 1175.38 g/mol |
| Exact Mass | 1174.72 |
| IUPAC Name | 1-O-(2-hexyldecyl) 13-O-(2-hexyloctyl) 7-[4-(dimethylamino)butyl-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]tridecanedioate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCC(CCCCCC(=O)OCC(CCCCCC)CCCCCC)N(CCCCN(C)C)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C57H97F15N2O5/c1-7-11-15-19-20-26-36-46(35-25-18-14-10-4)44-79-49(76)40-30-22-28-38-47(37-27-21-29-39-48(75)78-43-45(33-23-16-12-8-2)34-24-17-13-9-3)74(42-32-31-41-73(5)6)50(77)51(58,59)52(60,61)53(62,63)54(64,65)55(66,67)56(68,69)57(70,71)72/h45-47H,7-44H2,1-6H3 |
| InChIKey | PBVKOANCBVMSPZ-UHFFFAOYSA-N |
| XLogP | 18.78 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1175.38 |
| LogP ≤ 5 | 18.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|