C62H120N2O5 — CID 146552089
1-O-(2-butyloctyl) 19-O-(2-pentyloctyl) 10-[decanoyl(3-piperidin-1-ylpropyl)amino]nonadecanedioate (PubChem CID 146552089) has the molecular formula C62H120N2O5 and a molecular weight of 973.65 g/mol. Its IUPAC name is 1-O-(2-butyloctyl) 19-O-(2-pentyloctyl) 10-[decanoyl(3-piperidin-1-ylpropyl)amino]nonadecanedioate.
| Compound Name | 1-O-(2-butyloctyl) 19-O-(2-pentyloctyl) 10-[decanoyl(3-piperidin-1-ylpropyl)amino]nonadecanedioate |
|---|---|
| PubChem CID | 146552089 |
| Molecular Formula | C62H120N2O5 |
| Molecular Weight | 973.65 g/mol |
| Exact Mass | 972.92 |
| IUPAC Name | 1-O-(2-butyloctyl) 19-O-(2-pentyloctyl) 10-[decanoyl(3-piperidin-1-ylpropyl)amino]nonadecanedioate |
| SMILES | CCCCCCCCCC(=O)N(CCCN1CCCCC1)C(CCCCCCCCC(=O)OCC(CCCC)CCCCCC)CCCCCCCCC(=O)OCC(CCCCC)CCCCCC |
| InChI | InChI=1S/C62H120N2O5/c1-6-11-16-19-20-27-36-48-60(65)64(54-41-53-63-51-39-30-40-52-63)59(46-34-25-21-23-28-37-49-61(66)68-55-57(42-15-10-5)44-32-17-12-7-2)47-35-26-22-24-29-38-50-62(67)69-56-58(43-31-14-9-4)45-33-18-13-8-3/h57-59H,6-56H2,1-5H3 |
| InChIKey | DAFUBSRHIMAOHR-UHFFFAOYSA-N |
| XLogP | 18.47 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.65 |
| LogP ≤ 5 | 18.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|