C49H96N2O4 — CID 164814121
2-octyldecyl 3-[[3-(2-octyldecoxy)-3-oxopropyl]-(2-piperidin-1-ylethyl)amino]propanoate (PubChem CID 164814121) has the molecular formula C49H96N2O4 and a molecular weight of 777.32 g/mol. Its IUPAC name is 2-octyldecyl 3-[[3-(2-octyldecoxy)-3-oxopropyl]-(2-piperidin-1-ylethyl)amino]propanoate.
| Compound Name | 2-octyldecyl 3-[[3-(2-octyldecoxy)-3-oxopropyl]-(2-piperidin-1-ylethyl)amino]propanoate |
|---|---|
| PubChem CID | 164814121 |
| Molecular Formula | C49H96N2O4 |
| Molecular Weight | 777.32 g/mol |
| Exact Mass | 776.74 |
| IUPAC Name | 2-octyldecyl 3-[[3-(2-octyldecoxy)-3-oxopropyl]-(2-piperidin-1-ylethyl)amino]propanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)COC(=O)CCN(CCC(=O)OCC(CCCCCCCC)CCCCCCCC)CCN1CCCCC1 |
| InChI | InChI=1S/C49H96N2O4/c1-5-9-13-17-21-26-32-46(33-27-22-18-14-10-6-2)44-54-48(52)36-40-51(43-42-50-38-30-25-31-39-50)41-37-49(53)55-45-47(34-28-23-19-15-11-7-3)35-29-24-20-16-12-8-4/h46-47H,5-45H2,1-4H3 |
| InChIKey | LHQLDPKHUXUXEY-UHFFFAOYSA-N |
| XLogP | 13.88 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.32 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|