C42H80N2O6S2 — CID 171658866
2-[3-[[3-[2-(decyldisulfanyl)ethoxy]-3-oxopropyl]-(3-pyrrolidin-1-ylpropyl)amino]propanoyloxy]ethyl 3-butylundecanoate (PubChem CID 171658866) has the molecular formula C42H80N2O6S2 and a molecular weight of 773.24 g/mol. Its IUPAC name is 2-[3-[[3-[2-(decyldisulfanyl)ethoxy]-3-oxopropyl]-(3-pyrrolidin-1-ylpropyl)amino]propanoyloxy]ethyl 3-butylundecanoate.
| Compound Name | 2-[3-[[3-[2-(decyldisulfanyl)ethoxy]-3-oxopropyl]-(3-pyrrolidin-1-ylpropyl)amino]propanoyloxy]ethyl 3-butylundecanoate |
|---|---|
| PubChem CID | 171658866 |
| Molecular Formula | C42H80N2O6S2 |
| Molecular Weight | 773.24 g/mol |
| Exact Mass | 772.55 |
| IUPAC Name | 2-[3-[[3-[2-(decyldisulfanyl)ethoxy]-3-oxopropyl]-(3-pyrrolidin-1-ylpropyl)amino]propanoyloxy]ethyl 3-butylundecanoate |
| SMILES | CCCCCCCCCCSSCCOC(=O)CCN(CCCN1CCCC1)CCC(=O)OCCOC(=O)CC(CCCC)CCCCCCCC |
| InChI | InChI=1S/C42H80N2O6S2/c1-4-7-10-12-14-15-17-21-36-51-52-37-35-50-41(46)26-32-44(30-22-29-43-27-19-20-28-43)31-25-40(45)48-33-34-49-42(47)38-39(23-9-6-3)24-18-16-13-11-8-5-2/h39H,4-38H2,1-3H3 |
| InChIKey | WMTGHGAVKFGVFN-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.24 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|