C62H122N2O5 — CID 154993819
2-butyloctyl 19-(2-butyloctoxy)-10-[decyl(5-pyrrolidin-1-ylpentanoyl)amino]-19-hydroxynonadecanoate (PubChem CID 154993819) has the molecular formula C62H122N2O5 and a molecular weight of 975.67 g/mol. Its IUPAC name is 2-butyloctyl 19-(2-butyloctoxy)-10-[decyl(5-pyrrolidin-1-ylpentanoyl)amino]-19-hydroxynonadecanoate.
| Compound Name | 2-butyloctyl 19-(2-butyloctoxy)-10-[decyl(5-pyrrolidin-1-ylpentanoyl)amino]-19-hydroxynonadecanoate |
|---|---|
| PubChem CID | 154993819 |
| Molecular Formula | C62H122N2O5 |
| Molecular Weight | 975.67 g/mol |
| Exact Mass | 974.94 |
| IUPAC Name | 2-butyloctyl 19-(2-butyloctoxy)-10-[decyl(5-pyrrolidin-1-ylpentanoyl)amino]-19-hydroxynonadecanoate |
| SMILES | CCCCCCCCCCN(C(=O)CCCCN1CCCC1)C(CCCCCCCCC(=O)OCC(CCCC)CCCCCC)CCCCCCCCC(O)OCC(CCCC)CCCCCC |
| InChI | InChI=1S/C62H122N2O5/c1-6-11-16-19-20-25-30-38-54-64(60(65)48-37-39-51-63-52-40-41-53-63)59(46-33-26-21-23-28-35-49-61(66)68-55-57(42-14-9-4)44-31-17-12-7-2)47-34-27-22-24-29-36-50-62(67)69-56-58(43-15-10-5)45-32-18-13-8-3/h57-59,61,66H,6-56H2,1-5H3 |
| InChIKey | IBDLPOURHHJUBW-UHFFFAOYSA-N |
| XLogP | 18.26 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.67 |
| LogP ≤ 5 | 18.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|